C14H11BrCl2O2 — CID 65326523
1-bromo-2-[(2,3-dichlorophenoxy)methyl]-4-methoxybenzene (PubChem CID 65326523) has the molecular formula C14H11BrCl2O2 and a molecular weight of 362.05 g/mol. Its IUPAC name is 1-bromo-2-[(2,3-dichlorophenoxy)methyl]-4-methoxybenzene.
| Compound Name | 1-bromo-2-[(2,3-dichlorophenoxy)methyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 65326523 |
| Molecular Formula | C14H11BrCl2O2 |
| Molecular Weight | 362.05 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 1-bromo-2-[(2,3-dichlorophenoxy)methyl]-4-methoxybenzene |
| SMILES | COc1ccc(Br)c(COc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H11BrCl2O2/c1-18-10-5-6-11(15)9(7-10)8-19-13-4-2-3-12(16)14(13)17/h2-7H,8H2,1H3 |
| InChIKey | RIQVYWYLCKRBOO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.05 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |