C14H10BrCl2FO2 — CID 43516255
[2-[(4-bromo-2-fluorophenyl)methoxy]-3,5-dichlorophenyl]methanol (PubChem CID 43516255) has the molecular formula C14H10BrCl2FO2 and a molecular weight of 380.04 g/mol. Its IUPAC name is [2-[(4-bromo-2-fluorophenyl)methoxy]-3,5-dichlorophenyl]methanol.
| Compound Name | [2-[(4-bromo-2-fluorophenyl)methoxy]-3,5-dichlorophenyl]methanol |
|---|---|
| PubChem CID | 43516255 |
| Molecular Formula | C14H10BrCl2FO2 |
| Molecular Weight | 380.04 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | [2-[(4-bromo-2-fluorophenyl)methoxy]-3,5-dichlorophenyl]methanol |
| SMILES | OCc1cc(Cl)cc(Cl)c1OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H10BrCl2FO2/c15-10-2-1-8(13(18)4-10)7-20-14-9(6-19)3-11(16)5-12(14)17/h1-5,19H,6-7H2 |
| InChIKey | ZZQVNIXSBKQYHE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.04 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |