C14H10Cl2F2O2 — CID 62196694
[3,5-dichloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methanol (PubChem CID 62196694) has the molecular formula C14H10Cl2F2O2 and a molecular weight of 319.13 g/mol. Its IUPAC name is [3,5-dichloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methanol.
| Compound Name | [3,5-dichloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 62196694 |
| Molecular Formula | C14H10Cl2F2O2 |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | [3,5-dichloro-2-[(2,4-difluorophenyl)methoxy]phenyl]methanol |
| SMILES | OCc1cc(Cl)cc(Cl)c1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C14H10Cl2F2O2/c15-10-3-9(6-19)14(12(16)4-10)20-7-8-1-2-11(17)5-13(8)18/h1-5,19H,6-7H2 |
| InChIKey | PTYCASCVLPBUNI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |