C14H9Br4FO — CID 107745679
1,3-dibromo-2-[(4-bromo-2-fluorophenyl)methoxy]-5-(bromomethyl)benzene (PubChem CID 107745679) has the molecular formula C14H9Br4FO and a molecular weight of 531.84 g/mol. Its IUPAC name is 1,3-dibromo-2-[(4-bromo-2-fluorophenyl)methoxy]-5-(bromomethyl)benzene.
| Compound Name | 1,3-dibromo-2-[(4-bromo-2-fluorophenyl)methoxy]-5-(bromomethyl)benzene |
|---|---|
| PubChem CID | 107745679 |
| Molecular Formula | C14H9Br4FO |
| Molecular Weight | 531.84 g/mol |
| Exact Mass | 527.74 |
| IUPAC Name | 1,3-dibromo-2-[(4-bromo-2-fluorophenyl)methoxy]-5-(bromomethyl)benzene |
| SMILES | Fc1cc(Br)ccc1COc1c(Br)cc(CBr)cc1Br |
| InChI | InChI=1S/C14H9Br4FO/c15-6-8-3-11(17)14(12(18)4-8)20-7-9-1-2-10(16)5-13(9)19/h1-5H,6-7H2 |
| InChIKey | GWFHKAIAJRVNPZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.84 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|