C16H12BrCl2NO — CID 103428250
1-[(2-bromo-5-methoxyphenyl)methyl]-4,6-dichloroindole (PubChem CID 103428250) has the molecular formula C16H12BrCl2NO and a molecular weight of 385.09 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxyphenyl)methyl]-4,6-dichloroindole.
| Compound Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-4,6-dichloroindole |
|---|---|
| PubChem CID | 103428250 |
| Molecular Formula | C16H12BrCl2NO |
| Molecular Weight | 385.09 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-4,6-dichloroindole |
| SMILES | COc1ccc(Br)c(Cn2ccc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C16H12BrCl2NO/c1-21-12-2-3-14(17)10(6-12)9-20-5-4-13-15(19)7-11(18)8-16(13)20/h2-8H,9H2,1H3 |
| InChIKey | XTVRPLJHPFINEI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.09 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |