C16H12Cl2FNO — CID 103428306
4,6-dichloro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole (PubChem CID 103428306) has the molecular formula C16H12Cl2FNO and a molecular weight of 324.18 g/mol. Its IUPAC name is 4,6-dichloro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole.
| Compound Name | 4,6-dichloro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole |
|---|---|
| PubChem CID | 103428306 |
| Molecular Formula | C16H12Cl2FNO |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 4,6-dichloro-1-[(3-fluoro-4-methoxyphenyl)methyl]indole |
| SMILES | COc1ccc(Cn2ccc3c(Cl)cc(Cl)cc32)cc1F |
| InChI | InChI=1S/C16H12Cl2FNO/c1-21-16-3-2-10(6-14(16)19)9-20-5-4-12-13(18)7-11(17)8-15(12)20/h2-8H,9H2,1H3 |
| InChIKey | QWPQEBFSRVEIOB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |