C17H15Cl2N — CID 103428167
4,6-dichloro-1-[(4-ethylphenyl)methyl]indole (PubChem CID 103428167) has the molecular formula C17H15Cl2N and a molecular weight of 304.22 g/mol. Its IUPAC name is 4,6-dichloro-1-[(4-ethylphenyl)methyl]indole.
| Compound Name | 4,6-dichloro-1-[(4-ethylphenyl)methyl]indole |
|---|---|
| PubChem CID | 103428167 |
| Molecular Formula | C17H15Cl2N |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 4,6-dichloro-1-[(4-ethylphenyl)methyl]indole |
| SMILES | CCc1ccc(Cn2ccc3c(Cl)cc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H15Cl2N/c1-2-12-3-5-13(6-4-12)11-20-8-7-15-16(19)9-14(18)10-17(15)20/h3-10H,2,11H2,1H3 |
| InChIKey | BSVTWZBMVYDOMI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |