C13H15Cl2NO2S — CID 103428287
4,6-dichloro-1-(3-ethylsulfonylpropyl)indole (PubChem CID 103428287) has the molecular formula C13H15Cl2NO2S and a molecular weight of 320.24 g/mol. Its IUPAC name is 4,6-dichloro-1-(3-ethylsulfonylpropyl)indole.
| Compound Name | 4,6-dichloro-1-(3-ethylsulfonylpropyl)indole |
|---|---|
| PubChem CID | 103428287 |
| Molecular Formula | C13H15Cl2NO2S |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4,6-dichloro-1-(3-ethylsulfonylpropyl)indole |
| SMILES | CCS(=O)(=O)CCCn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C13H15Cl2NO2S/c1-2-19(17,18)7-3-5-16-6-4-11-12(15)8-10(14)9-13(11)16/h4,6,8-9H,2-3,5,7H2,1H3 |
| InChIKey | DUCUQBQDTIFMEB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |