C13H14Cl2N2O — CID 103428284
2-(4,6-dichloroindol-1-yl)-N-ethyl-N-methylacetamide (PubChem CID 103428284) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-(4,6-dichloroindol-1-yl)-N-ethyl-N-methylacetamide.
| Compound Name | 2-(4,6-dichloroindol-1-yl)-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 103428284 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-(4,6-dichloroindol-1-yl)-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)Cn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C13H14Cl2N2O/c1-3-16(2)13(18)8-17-5-4-10-11(15)6-9(14)7-12(10)17/h4-7H,3,8H2,1-2H3 |
| InChIKey | AQEZAWFBBITEPN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |