C16H10Cl2FNO — CID 103427998
2-(4,6-dichloroindol-1-yl)-1-(2-fluorophenyl)ethanone (PubChem CID 103427998) has the molecular formula C16H10Cl2FNO and a molecular weight of 322.17 g/mol. Its IUPAC name is 2-(4,6-dichloroindol-1-yl)-1-(2-fluorophenyl)ethanone.
| Compound Name | 2-(4,6-dichloroindol-1-yl)-1-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 103427998 |
| Molecular Formula | C16H10Cl2FNO |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2-(4,6-dichloroindol-1-yl)-1-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cn1ccc2c(Cl)cc(Cl)cc21)c1ccccc1F |
| InChI | InChI=1S/C16H10Cl2FNO/c17-10-7-13(18)11-5-6-20(15(11)8-10)9-16(21)12-3-1-2-4-14(12)19/h1-8H,9H2 |
| InChIKey | GBXJXQFOWZXNJP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |