C11H7Cl4N — CID 103428376
4,6-dichloro-1-[(E)-2,3-dichloroprop-2-enyl]indole (PubChem CID 103428376) has the molecular formula C11H7Cl4N and a molecular weight of 295.00 g/mol. Its IUPAC name is 4,6-dichloro-1-[(E)-2,3-dichloroprop-2-enyl]indole.
| Compound Name | 4,6-dichloro-1-[(E)-2,3-dichloroprop-2-enyl]indole |
|---|---|
| PubChem CID | 103428376 |
| Molecular Formula | C11H7Cl4N |
| Molecular Weight | 295.00 g/mol |
| Exact Mass | 292.93 |
| IUPAC Name | 4,6-dichloro-1-[(E)-2,3-dichloroprop-2-enyl]indole |
| SMILES | Cl/C=C(/Cl)Cn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C11H7Cl4N/c12-5-8(14)6-16-2-1-9-10(15)3-7(13)4-11(9)16/h1-5H,6H2/b8-5+ |
| InChIKey | DBQSCHKYVJTELV-VMPITWQZSA-N |
| XLogP | 5.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.00 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |