C14H16Cl2N2O — CID 103428177
4-(4,6-dichloroindol-1-yl)-N,N-dimethylbutanamide (PubChem CID 103428177) has the molecular formula C14H16Cl2N2O and a molecular weight of 299.20 g/mol. Its IUPAC name is 4-(4,6-dichloroindol-1-yl)-N,N-dimethylbutanamide.
| Compound Name | 4-(4,6-dichloroindol-1-yl)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 103428177 |
| Molecular Formula | C14H16Cl2N2O |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 4-(4,6-dichloroindol-1-yl)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C14H16Cl2N2O/c1-17(2)14(19)4-3-6-18-7-5-11-12(16)8-10(15)9-13(11)18/h5,7-9H,3-4,6H2,1-2H3 |
| InChIKey | XXKFHFPRQJEFEZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |