C14H15Cl2NO2 — CID 103427749
methyl 3-(4,6-dichloroindol-1-yl)-2,2-dimethylpropanoate (PubChem CID 103427749) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is methyl 3-(4,6-dichloroindol-1-yl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(4,6-dichloroindol-1-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 103427749 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 3-(4,6-dichloroindol-1-yl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C14H15Cl2NO2/c1-14(2,13(18)19-3)8-17-5-4-10-11(16)6-9(15)7-12(10)17/h4-7H,8H2,1-3H3 |
| InChIKey | SXHFZFFUMQIEHG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |