C14H17Cl2N3O — CID 103428130
6-(4,6-dichloroindol-1-yl)hexanehydrazide (PubChem CID 103428130) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 6-(4,6-dichloroindol-1-yl)hexanehydrazide.
| Compound Name | 6-(4,6-dichloroindol-1-yl)hexanehydrazide |
|---|---|
| PubChem CID | 103428130 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 6-(4,6-dichloroindol-1-yl)hexanehydrazide |
| SMILES | NNC(=O)CCCCCn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C14H17Cl2N3O/c15-10-8-12(16)11-5-7-19(13(11)9-10)6-3-1-2-4-14(20)18-17/h5,7-9H,1-4,6,17H2,(H,18,20) |
| InChIKey | MYYYNEOTFCMVRB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|