C14H11Cl2N3O2 — CID 103428139
5-[(4,6-dichloroindol-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 103428139) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 5-[(4,6-dichloroindol-1-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 5-[(4,6-dichloroindol-1-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 103428139 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 5-[(4,6-dichloroindol-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | NNC(=O)c1coc(Cn2ccc3c(Cl)cc(Cl)cc32)c1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-9-4-12(16)11-1-2-19(13(11)5-9)6-10-3-8(7-21-10)14(20)18-17/h1-5,7H,6,17H2,(H,18,20) |
| InChIKey | IRSQQYYOGBSKMH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|