C11H11Cl2NO2S — CID 103428479
4,6-dichloro-1-(2-methylsulfonylethyl)indole (PubChem CID 103428479) has the molecular formula C11H11Cl2NO2S and a molecular weight of 292.19 g/mol. Its IUPAC name is 4,6-dichloro-1-(2-methylsulfonylethyl)indole.
| Compound Name | 4,6-dichloro-1-(2-methylsulfonylethyl)indole |
|---|---|
| PubChem CID | 103428479 |
| Molecular Formula | C11H11Cl2NO2S |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 4,6-dichloro-1-(2-methylsulfonylethyl)indole |
| SMILES | CS(=O)(=O)CCn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C11H11Cl2NO2S/c1-17(15,16)5-4-14-3-2-9-10(13)6-8(12)7-11(9)14/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | IMQSWAUUFFTONH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |