C11H11Cl2NS — CID 103428339
4,6-dichloro-1-(2-methylsulfanylethyl)indole (PubChem CID 103428339) has the molecular formula C11H11Cl2NS and a molecular weight of 260.19 g/mol. Its IUPAC name is 4,6-dichloro-1-(2-methylsulfanylethyl)indole.
| Compound Name | 4,6-dichloro-1-(2-methylsulfanylethyl)indole |
|---|---|
| PubChem CID | 103428339 |
| Molecular Formula | C11H11Cl2NS |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 4,6-dichloro-1-(2-methylsulfanylethyl)indole |
| SMILES | CSCCn1ccc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C11H11Cl2NS/c1-15-5-4-14-3-2-9-10(13)6-8(12)7-11(9)14/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | ASYWGCQJEFGQFE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |