C15H10Cl2IN — CID 103428355
4,6-dichloro-1-[(4-iodophenyl)methyl]indole (PubChem CID 103428355) has the molecular formula C15H10Cl2IN and a molecular weight of 402.06 g/mol. Its IUPAC name is 4,6-dichloro-1-[(4-iodophenyl)methyl]indole.
| Compound Name | 4,6-dichloro-1-[(4-iodophenyl)methyl]indole |
|---|---|
| PubChem CID | 103428355 |
| Molecular Formula | C15H10Cl2IN |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 400.92 |
| IUPAC Name | 4,6-dichloro-1-[(4-iodophenyl)methyl]indole |
| SMILES | Clc1cc(Cl)c2ccn(Cc3ccc(I)cc3)c2c1 |
| InChI | InChI=1S/C15H10Cl2IN/c16-11-7-14(17)13-5-6-19(15(13)8-11)9-10-1-3-12(18)4-2-10/h1-8H,9H2 |
| InChIKey | QGQNQTRGCLEPPS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|