C16H17Cl2N3 — CID 103428325
4,6-dichloro-1-[(1,3-diethylpyrazol-5-yl)methyl]indole (PubChem CID 103428325) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 4,6-dichloro-1-[(1,3-diethylpyrazol-5-yl)methyl]indole.
| Compound Name | 4,6-dichloro-1-[(1,3-diethylpyrazol-5-yl)methyl]indole |
|---|---|
| PubChem CID | 103428325 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4,6-dichloro-1-[(1,3-diethylpyrazol-5-yl)methyl]indole |
| SMILES | CCc1cc(Cn2ccc3c(Cl)cc(Cl)cc32)n(CC)n1 |
| InChI | InChI=1S/C16H17Cl2N3/c1-3-12-9-13(21(4-2)19-12)10-20-6-5-14-15(18)7-11(17)8-16(14)20/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | WQUOTHOEEMEYJQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |