C15H9Cl2F2N — CID 103428267
4,6-dichloro-1-[(2,3-difluorophenyl)methyl]indole (PubChem CID 103428267) has the molecular formula C15H9Cl2F2N and a molecular weight of 312.15 g/mol. Its IUPAC name is 4,6-dichloro-1-[(2,3-difluorophenyl)methyl]indole.
| Compound Name | 4,6-dichloro-1-[(2,3-difluorophenyl)methyl]indole |
|---|---|
| PubChem CID | 103428267 |
| Molecular Formula | C15H9Cl2F2N |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4,6-dichloro-1-[(2,3-difluorophenyl)methyl]indole |
| SMILES | Fc1cccc(Cn2ccc3c(Cl)cc(Cl)cc32)c1F |
| InChI | InChI=1S/C15H9Cl2F2N/c16-10-6-12(17)11-4-5-20(14(11)7-10)8-9-2-1-3-13(18)15(9)19/h1-7H,8H2 |
| InChIKey | DWXORNPROYSFMJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |