C16H10BrCl2NO — CID 103427977
1-(3-bromophenyl)-2-(4,6-dichloroindol-1-yl)ethanone (PubChem CID 103427977) has the molecular formula C16H10BrCl2NO and a molecular weight of 383.07 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(4,6-dichloroindol-1-yl)ethanone.
| Compound Name | 1-(3-bromophenyl)-2-(4,6-dichloroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 103427977 |
| Molecular Formula | C16H10BrCl2NO |
| Molecular Weight | 383.07 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | 1-(3-bromophenyl)-2-(4,6-dichloroindol-1-yl)ethanone |
| SMILES | O=C(Cn1ccc2c(Cl)cc(Cl)cc21)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H10BrCl2NO/c17-11-3-1-2-10(6-11)16(21)9-20-5-4-13-14(19)7-12(18)8-15(13)20/h1-8H,9H2 |
| InChIKey | NAWRAVIKWUFGCN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.07 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |