C9H9Cl2N3O2S — CID 134122788
N-(aminocarbamothioyl)-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 134122788) has the molecular formula C9H9Cl2N3O2S and a molecular weight of 294.16 g/mol. Its IUPAC name is N-(aminocarbamothioyl)-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-(aminocarbamothioyl)-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 134122788 |
| Molecular Formula | C9H9Cl2N3O2S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | N-(aminocarbamothioyl)-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | NNC(=S)NC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H9Cl2N3O2S/c10-5-1-2-7(6(11)3-5)16-4-8(15)13-9(17)14-12/h1-3H,4,12H2,(H2,13,14,15,17) |
| InChIKey | JWGNMGZGTGQGSR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|