C17H16Cl2N2O2S — CID 4659055
2-(2,4-dichlorophenoxy)-N-(2-phenylethylcarbamothioyl)acetamide (PubChem CID 4659055) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2-phenylethylcarbamothioyl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2-phenylethylcarbamothioyl)acetamide |
|---|---|
| PubChem CID | 4659055 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2-phenylethylcarbamothioyl)acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NC(=S)NCCc1ccccc1 |
| InChI | InChI=1S/C17H16Cl2N2O2S/c18-13-6-7-15(14(19)10-13)23-11-16(22)21-17(24)20-9-8-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H2,20,21,22,24) |
| InChIKey | CUYGYCYEZXVMTA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|