C17H16ClNO4 — CID 45418647
3-chloro-4-[2-oxo-2-(2-phenylethylamino)ethoxy]benzoic acid (PubChem CID 45418647) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is 3-chloro-4-[2-oxo-2-(2-phenylethylamino)ethoxy]benzoic acid.
| Compound Name | 3-chloro-4-[2-oxo-2-(2-phenylethylamino)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 45418647 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-chloro-4-[2-oxo-2-(2-phenylethylamino)ethoxy]benzoic acid |
| SMILES | O=C(COc1ccc(C(=O)O)cc1Cl)NCCc1ccccc1 |
| InChI | InChI=1S/C17H16ClNO4/c18-14-10-13(17(21)22)6-7-15(14)23-11-16(20)19-9-8-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H,19,20)(H,21,22) |
| InChIKey | UHZHSYUHGCOEBD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |