C18H17Cl2N3O3S — CID 4630948
N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide (PubChem CID 4630948) has the molecular formula C18H17Cl2N3O3S and a molecular weight of 426.33 g/mol. Its IUPAC name is N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide.
| Compound Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 4630948 |
| Molecular Formula | C18H17Cl2N3O3S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | N-[[4-[acetyl(methyl)amino]phenyl]carbamothioyl]-2-(2,4-dichlorophenoxy)acetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=S)NC(=O)COc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H17Cl2N3O3S/c1-11(24)23(2)14-6-4-13(5-7-14)21-18(27)22-17(25)10-26-16-8-3-12(19)9-15(16)20/h3-9H,10H2,1-2H3,(H2,21,22,25,27) |
| InChIKey | OFTNMEMTMFEACF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|