C16H15Cl2N3OS — CID 19649161
N-[4-[(2,4-dichlorophenyl)carbamothioylamino]phenyl]-N-methylacetamide (PubChem CID 19649161) has the molecular formula C16H15Cl2N3OS and a molecular weight of 368.29 g/mol. Its IUPAC name is N-[4-[(2,4-dichlorophenyl)carbamothioylamino]phenyl]-N-methylacetamide.
| Compound Name | N-[4-[(2,4-dichlorophenyl)carbamothioylamino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 19649161 |
| Molecular Formula | C16H15Cl2N3OS |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | N-[4-[(2,4-dichlorophenyl)carbamothioylamino]phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(NC(=S)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2N3OS/c1-10(22)21(2)13-6-4-12(5-7-13)19-16(23)20-15-8-3-11(17)9-14(15)18/h3-9H,1-2H3,(H2,19,20,23) |
| InChIKey | LSDUMZURHMVTIB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|