C15H12Cl4N4S2 — CID 2370185
3-(2,4-dichlorophenyl)-1-[(2,4-dichlorophenyl)carbamothioylamino]-1-methylthiourea (PubChem CID 2370185) has the molecular formula C15H12Cl4N4S2 and a molecular weight of 454.24 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[(2,4-dichlorophenyl)carbamothioylamino]-1-methylthiourea.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[(2,4-dichlorophenyl)carbamothioylamino]-1-methylthiourea |
|---|---|
| PubChem CID | 2370185 |
| Molecular Formula | C15H12Cl4N4S2 |
| Molecular Weight | 454.24 g/mol |
| Exact Mass | 451.93 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[(2,4-dichlorophenyl)carbamothioylamino]-1-methylthiourea |
| SMILES | CN(NC(=S)Nc1ccc(Cl)cc1Cl)C(=S)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl4N4S2/c1-23(15(25)21-13-5-3-9(17)7-11(13)19)22-14(24)20-12-4-2-8(16)6-10(12)18/h2-7H,1H3,(H,21,25)(H2,20,22,24) |
| InChIKey | ZORQXWGOYVCUJC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.24 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|