C8H9Cl2N3S — CID 2806904
1-amino-3-(2,5-dichlorophenyl)-1-methylthiourea (PubChem CID 2806904) has the molecular formula C8H9Cl2N3S and a molecular weight of 250.15 g/mol. Its IUPAC name is 1-amino-3-(2,5-dichlorophenyl)-1-methylthiourea.
| Compound Name | 1-amino-3-(2,5-dichlorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 2806904 |
| Molecular Formula | C8H9Cl2N3S |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 1-amino-3-(2,5-dichlorophenyl)-1-methylthiourea |
| SMILES | CN(N)C(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H9Cl2N3S/c1-13(11)8(14)12-7-4-5(9)2-3-6(7)10/h2-4H,11H2,1H3,(H,12,14) |
| InChIKey | ZLKUABKKAXTBMG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|