C10H12Cl2N2O3 — CID 113249966
1-(2,5-dichlorophenyl)-3-(2-methoxyethoxy)urea (PubChem CID 113249966) has the molecular formula C10H12Cl2N2O3 and a molecular weight of 279.12 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-(2-methoxyethoxy)urea.
| Compound Name | 1-(2,5-dichlorophenyl)-3-(2-methoxyethoxy)urea |
|---|---|
| PubChem CID | 113249966 |
| Molecular Formula | C10H12Cl2N2O3 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-(2-methoxyethoxy)urea |
| SMILES | COCCONC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O3/c1-16-4-5-17-14-10(15)13-9-6-7(11)2-3-8(9)12/h2-3,6H,4-5H2,1H3,(H2,13,14,15) |
| InChIKey | KAYAASFTUPPLOL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|