C10H9Cl2N3O2S — CID 43316125
N-(2-amino-2-sulfanylideneethyl)-N'-(2,5-dichlorophenyl)oxamide (PubChem CID 43316125) has the molecular formula C10H9Cl2N3O2S and a molecular weight of 306.17 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2,5-dichlorophenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 43316125 |
| Molecular Formula | C10H9Cl2N3O2S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2,5-dichlorophenyl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C10H9Cl2N3O2S/c11-5-1-2-6(12)7(3-5)15-10(17)9(16)14-4-8(13)18/h1-3H,4H2,(H2,13,18)(H,14,16)(H,15,17) |
| InChIKey | JDVOUZOKQSBGON-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|