C10H9BrFN3O2S — CID 43316429
N-(2-amino-2-sulfanylideneethyl)-N'-(2-bromo-4-fluorophenyl)oxamide (PubChem CID 43316429) has the molecular formula C10H9BrFN3O2S and a molecular weight of 334.17 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-(2-bromo-4-fluorophenyl)oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2-bromo-4-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 43316429 |
| Molecular Formula | C10H9BrFN3O2S |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-(2-bromo-4-fluorophenyl)oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C10H9BrFN3O2S/c11-6-3-5(12)1-2-7(6)15-10(17)9(16)14-4-8(13)18/h1-3H,4H2,(H2,13,18)(H,14,16)(H,15,17) |
| InChIKey | LOUBUYNJEWRNGO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|