C11H9BrF3N3O2S — CID 64854956
N-(2-amino-2-sulfanylideneethyl)-N'-[4-bromo-3-(trifluoromethyl)phenyl]oxamide (PubChem CID 64854956) has the molecular formula C11H9BrF3N3O2S and a molecular weight of 384.18 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-[4-bromo-3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-[4-bromo-3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 64854956 |
| Molecular Formula | C11H9BrF3N3O2S |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-[4-bromo-3-(trifluoromethyl)phenyl]oxamide |
| SMILES | NC(=S)CNC(=O)C(=O)Nc1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9BrF3N3O2S/c12-7-2-1-5(3-6(7)11(13,14)15)18-10(20)9(19)17-4-8(16)21/h1-3H,4H2,(H2,16,21)(H,17,19)(H,18,20) |
| InChIKey | VOVSSORALLCVBS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|