C15H11BrF3N3OS — CID 18463514
4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamothioylamino]benzamide (PubChem CID 18463514) has the molecular formula C15H11BrF3N3OS and a molecular weight of 418.24 g/mol. Its IUPAC name is 4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamothioylamino]benzamide.
| Compound Name | 4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 18463514 |
| Molecular Formula | C15H11BrF3N3OS |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=S)Nc2ccc(Br)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H11BrF3N3OS/c16-12-6-5-10(7-11(12)15(17,18)19)22-14(24)21-9-3-1-8(2-4-9)13(20)23/h1-7H,(H2,20,23)(H2,21,22,24) |
| InChIKey | YPRHZPRNMSZIMI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|