C16H13F4N3OS — CID 18416426
4-[[4-fluoro-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]benzamide (PubChem CID 18416426) has the molecular formula C16H13F4N3OS and a molecular weight of 371.36 g/mol. Its IUPAC name is 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]benzamide.
| Compound Name | 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 18416426 |
| Molecular Formula | C16H13F4N3OS |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=S)NCc2ccc(F)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H13F4N3OS/c17-13-6-1-9(7-12(13)16(18,19)20)8-22-15(25)23-11-4-2-10(3-5-11)14(21)24/h1-7H,8H2,(H2,21,24)(H2,22,23,25) |
| InChIKey | DNRNQGNWMNOPIP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|