C15H13F2N3OS — CID 18416438
4-[(3,4-difluorophenyl)methylcarbamothioylamino]benzamide (PubChem CID 18416438) has the molecular formula C15H13F2N3OS and a molecular weight of 321.35 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methylcarbamothioylamino]benzamide.
| Compound Name | 4-[(3,4-difluorophenyl)methylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 18416438 |
| Molecular Formula | C15H13F2N3OS |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methylcarbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=S)NCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H13F2N3OS/c16-12-6-1-9(7-13(12)17)8-19-15(22)20-11-4-2-10(3-5-11)14(18)21/h1-7H,8H2,(H2,18,21)(H2,19,20,22) |
| InChIKey | VSQYZCKSOWZVMO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|