C16H16FN3OS — CID 18416397
4-[2-(3-fluorophenyl)ethylcarbamothioylamino]benzamide (PubChem CID 18416397) has the molecular formula C16H16FN3OS and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[2-(3-fluorophenyl)ethylcarbamothioylamino]benzamide.
| Compound Name | 4-[2-(3-fluorophenyl)ethylcarbamothioylamino]benzamide |
|---|---|
| PubChem CID | 18416397 |
| Molecular Formula | C16H16FN3OS |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[2-(3-fluorophenyl)ethylcarbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=S)NCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C16H16FN3OS/c17-13-3-1-2-11(10-13)8-9-19-16(22)20-14-6-4-12(5-7-14)15(18)21/h1-7,10H,8-9H2,(H2,18,21)(H2,19,20,22) |
| InChIKey | MECKNRSALVNTFL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|