C10H12FN3O2 — CID 43566530
N-[2-(3-fluorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide (PubChem CID 43566530) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 43566530 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-2-hydrazinyl-2-oxoacetamide |
| SMILES | NNC(=O)C(=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C10H12FN3O2/c11-8-3-1-2-7(6-8)4-5-13-9(15)10(16)14-12/h1-3,6H,4-5,12H2,(H,13,15)(H,14,16) |
| InChIKey | MADPDHORJHJIFI-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|