C14H13F2N3O — CID 43744882
[4-[(3,4-difluorophenyl)methylamino]phenyl]urea (PubChem CID 43744882) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is [4-[(3,4-difluorophenyl)methylamino]phenyl]urea.
| Compound Name | [4-[(3,4-difluorophenyl)methylamino]phenyl]urea |
|---|---|
| PubChem CID | 43744882 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [4-[(3,4-difluorophenyl)methylamino]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(NCc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H13F2N3O/c15-12-6-1-9(7-13(12)16)8-18-10-2-4-11(5-3-10)19-14(17)20/h1-7,18H,8H2,(H3,17,19,20) |
| InChIKey | LUQBBIZLMMHFCU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |