C13H10F2N2O2 — CID 115490715
5-[(3,4-difluorophenyl)methylamino]pyridine-2-carboxylic acid (PubChem CID 115490715) has the molecular formula C13H10F2N2O2 and a molecular weight of 264.23 g/mol. Its IUPAC name is 5-[(3,4-difluorophenyl)methylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-[(3,4-difluorophenyl)methylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115490715 |
| Molecular Formula | C13H10F2N2O2 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-[(3,4-difluorophenyl)methylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C13H10F2N2O2/c14-10-3-1-8(5-11(10)15)6-16-9-2-4-12(13(18)19)17-7-9/h1-5,7,16H,6H2,(H,18,19) |
| InChIKey | KARVQZQRNMPOLS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |