C14H12F2N2O2 — CID 115490672
5-[2-(3,5-difluorophenyl)ethylamino]pyridine-2-carboxylic acid (PubChem CID 115490672) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is 5-[2-(3,5-difluorophenyl)ethylamino]pyridine-2-carboxylic acid.
| Compound Name | 5-[2-(3,5-difluorophenyl)ethylamino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 115490672 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 5-[2-(3,5-difluorophenyl)ethylamino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(NCCc2cc(F)cc(F)c2)cn1 |
| InChI | InChI=1S/C14H12F2N2O2/c15-10-5-9(6-11(16)7-10)3-4-17-12-1-2-13(14(19)20)18-8-12/h1-2,5-8,17H,3-4H2,(H,19,20) |
| InChIKey | MFEKDVAWXFPDMC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |