C14H11F2N3OS — CID 63749197
5-carbamothioyl-N-[(3,4-difluorophenyl)methyl]pyridine-2-carboxamide (PubChem CID 63749197) has the molecular formula C14H11F2N3OS and a molecular weight of 307.33 g/mol. Its IUPAC name is 5-carbamothioyl-N-[(3,4-difluorophenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[(3,4-difluorophenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63749197 |
| Molecular Formula | C14H11F2N3OS |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-carbamothioyl-N-[(3,4-difluorophenyl)methyl]pyridine-2-carboxamide |
| SMILES | NC(=S)c1ccc(C(=O)NCc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C14H11F2N3OS/c15-10-3-1-8(5-11(10)16)6-19-14(20)12-4-2-9(7-18-12)13(17)21/h1-5,7H,6H2,(H2,17,21)(H,19,20) |
| InChIKey | WDZUTHAEOTZGFN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|