C24H22F4N4OS — CID 15955562
N-[4-[[4-(dimethylamino)-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]phenyl]-2-fluorobenzamide (PubChem CID 15955562) has the molecular formula C24H22F4N4OS and a molecular weight of 490.53 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[[4-(dimethylamino)-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 15955562 |
| Molecular Formula | C24H22F4N4OS |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[4-[[4-(dimethylamino)-3-(trifluoromethyl)phenyl]methylcarbamothioylamino]phenyl]-2-fluorobenzamide |
| SMILES | CN(C)c1ccc(CNC(=S)Nc2ccc(NC(=O)c3ccccc3F)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H22F4N4OS/c1-32(2)21-12-7-15(13-19(21)24(26,27)28)14-29-23(34)31-17-10-8-16(9-11-17)30-22(33)18-5-3-4-6-20(18)25/h3-13H,14H2,1-2H3,(H,30,33)(H2,29,31,34) |
| InChIKey | LWYOSBMHXMMNFE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|