C21H14F5N3OS — CID 152665029
2-fluoro-N-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide (PubChem CID 152665029) has the molecular formula C21H14F5N3OS and a molecular weight of 451.42 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 152665029 |
| Molecular Formula | C21H14F5N3OS |
| Molecular Weight | 451.42 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 2-fluoro-N-[4-[[3-fluoro-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2cc(F)cc(C(F)(F)F)c2)cc1)c1ccccc1F |
| InChI | InChI=1S/C21H14F5N3OS/c22-13-9-12(21(24,25)26)10-16(11-13)29-20(31)28-15-7-5-14(6-8-15)27-19(30)17-3-1-2-4-18(17)23/h1-11H,(H,27,30)(H2,28,29,31) |
| InChIKey | ZKIFKNIDPGOLNV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|