C25H22F4N4O2S — CID 15955556
2-fluoro-N-[4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide (PubChem CID 15955556) has the molecular formula C25H22F4N4O2S and a molecular weight of 518.54 g/mol. Its IUPAC name is 2-fluoro-N-[4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 15955556 |
| Molecular Formula | C25H22F4N4O2S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 2-fluoro-N-[4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NC(=S)Nc2cc(N3CCOCC3)cc(C(F)(F)F)c2)cc1)c1ccccc1F |
| InChI | InChI=1S/C25H22F4N4O2S/c26-22-4-2-1-3-21(22)23(34)30-17-5-7-18(8-6-17)31-24(36)32-19-13-16(25(27,28)29)14-20(15-19)33-9-11-35-12-10-33/h1-8,13-15H,9-12H2,(H,30,34)(H2,31,32,36) |
| InChIKey | NKOVRUNQXDVXGX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|