C19H19F3N4O2S — CID 18416442
4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]benzamide (PubChem CID 18416442) has the molecular formula C19H19F3N4O2S and a molecular weight of 424.45 g/mol. Its IUPAC name is 4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]benzamide.
| Compound Name | 4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 18416442 |
| Molecular Formula | C19H19F3N4O2S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 4-[[3-morpholin-4-yl-5-(trifluoromethyl)phenyl]carbamothioylamino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=S)Nc2cc(N3CCOCC3)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H19F3N4O2S/c20-19(21,22)13-9-15(11-16(10-13)26-5-7-28-8-6-26)25-18(29)24-14-3-1-12(2-4-14)17(23)27/h1-4,9-11H,5-8H2,(H2,23,27)(H2,24,25,29) |
| InChIKey | HYIQZMJFCCITTL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|