C19H16F6N2O2 — CID 2565226
N-(4-morpholin-4-ylphenyl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 2565226) has the molecular formula C19H16F6N2O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2565226 |
| Molecular Formula | C19H16F6N2O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F6N2O2/c20-18(21,22)13-9-12(10-14(11-13)19(23,24)25)17(28)26-15-1-3-16(4-2-15)27-5-7-29-8-6-27/h1-4,9-11H,5-8H2,(H,26,28) |
| InChIKey | RIBMWMJTLVJBIR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|