C26H23F3N4O3 — CID 155125670
N-[4-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 155125670) has the molecular formula C26H23F3N4O3 and a molecular weight of 496.49 g/mol. Its IUPAC name is N-[4-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155125670 |
| Molecular Formula | C26H23F3N4O3 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | N-[4-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(C=Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1)Nc1ccc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C26H23F3N4O3/c27-26(28,29)20-3-1-2-19(16-20)25(35)31-21-7-4-18(5-8-21)6-11-24(34)32-23-10-9-22(17-30-23)33-12-14-36-15-13-33/h1-11,16-17H,12-15H2,(H,31,35)(H,30,32,34) |
| InChIKey | RJIZRPVGCUJTAG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|