C25H22F3N5O3 — CID 155125561
5-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 155125561) has the molecular formula C25H22F3N5O3 and a molecular weight of 497.48 g/mol. Its IUPAC name is 5-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155125561 |
| Molecular Formula | C25H22F3N5O3 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 5-[3-[(5-morpholin-4-yl-2-pyridinyl)amino]-3-oxoprop-1-enyl]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(C=Cc1cncc(C(=O)Nc2cccc(C(F)(F)F)c2)c1)Nc1ccc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C25H22F3N5O3/c26-25(27,28)19-2-1-3-20(13-19)31-24(35)18-12-17(14-29-15-18)4-7-23(34)32-22-6-5-21(16-30-22)33-8-10-36-11-9-33/h1-7,12-16H,8-11H2,(H,31,35)(H,30,32,34) |
| InChIKey | KTZMXFOSHWJDJT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|