C23H18F6N4O2 — CID 41077695
N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 41077695) has the molecular formula C23H18F6N4O2 and a molecular weight of 496.41 g/mol. Its IUPAC name is N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 41077695 |
| Molecular Formula | C23H18F6N4O2 |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[3-(6-morpholin-4-ylpyridazin-3-yl)phenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCOCC3)nn2)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H18F6N4O2/c24-22(25,26)16-10-15(11-17(13-16)23(27,28)29)21(34)30-18-3-1-2-14(12-18)19-4-5-20(32-31-19)33-6-8-35-9-7-33/h1-5,10-13H,6-9H2,(H,30,34) |
| InChIKey | QKIIJWZBULMPAD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |