C24H23F3N4O — CID 41077791
N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 41077791) has the molecular formula C24H23F3N4O and a molecular weight of 440.47 g/mol. Its IUPAC name is N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 41077791 |
| Molecular Formula | C24H23F3N4O |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[3-[6-(azepan-1-yl)pyridazin-3-yl]phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(-c2ccc(N3CCCCCC3)nn2)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23F3N4O/c25-24(26,27)19-10-8-17(9-11-19)23(32)28-20-7-5-6-18(16-20)21-12-13-22(30-29-21)31-14-3-1-2-4-15-31/h5-13,16H,1-4,14-15H2,(H,28,32) |
| InChIKey | ZZCLOULCIHOBMF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |